C15H13ClN6O3 — CID 22987935
4-[3-(2-amino-6-chloropurin-9-yl)propanoylamino]benzoic acid (PubChem CID 22987935) has the molecular formula C15H13ClN6O3 and a molecular weight of 360.76 g/mol. Its IUPAC name is 4-[3-(2-amino-6-chloropurin-9-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[3-(2-amino-6-chloropurin-9-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 22987935 |
| Molecular Formula | C15H13ClN6O3 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-[3-(2-amino-6-chloropurin-9-yl)propanoylamino]benzoic acid |
| SMILES | Nc1nc(Cl)c2ncn(CCC(=O)Nc3ccc(C(=O)O)cc3)c2n1 |
| InChI | InChI=1S/C15H13ClN6O3/c16-12-11-13(21-15(17)20-12)22(7-18-11)6-5-10(23)19-9-3-1-8(2-4-9)14(24)25/h1-4,7H,5-6H2,(H,19,23)(H,24,25)(H2,17,20,21) |
| InChIKey | RTZJYEPHJPJPQK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |