C19H20ClN5O3 — CID 10501256
tert-butyl 3-(2-benzamido-6-chloropurin-9-yl)propanoate (PubChem CID 10501256) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is tert-butyl 3-(2-benzamido-6-chloropurin-9-yl)propanoate.
| Compound Name | tert-butyl 3-(2-benzamido-6-chloropurin-9-yl)propanoate |
|---|---|
| PubChem CID | 10501256 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | tert-butyl 3-(2-benzamido-6-chloropurin-9-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCn1cnc2c(Cl)nc(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C19H20ClN5O3/c1-19(2,3)28-13(26)9-10-25-11-21-14-15(20)22-18(23-16(14)25)24-17(27)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H,22,23,24,27) |
| InChIKey | YIEQONCJCSZADC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |