C19H32ClN5O3Si — CID 101468067
tert-butyl N-[9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloropurin-2-yl]carbamate (PubChem CID 101468067) has the molecular formula C19H32ClN5O3Si and a molecular weight of 442.04 g/mol. Its IUPAC name is tert-butyl N-[9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloropurin-2-yl]carbamate.
| Compound Name | tert-butyl N-[9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloropurin-2-yl]carbamate |
|---|---|
| PubChem CID | 101468067 |
| Molecular Formula | C19H32ClN5O3Si |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | tert-butyl N-[9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-chloropurin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(Cl)c2ncn(CCCO[Si](C)(C)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C19H32ClN5O3Si/c1-18(2,3)28-17(26)24-16-22-14(20)13-15(23-16)25(12-21-13)10-9-11-27-29(7,8)19(4,5)6/h12H,9-11H2,1-8H3,(H,22,23,24,26) |
| InChIKey | HKBVYBYIZNUPGI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|