C15H26N4OSi — CID 141198873
1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 141198873) has the molecular formula C15H26N4OSi and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 141198873 |
| Molecular Formula | C15H26N4OSi |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCn1cnc2c(N)nccc21 |
| InChI | InChI=1S/C15H26N4OSi/c1-15(2,3)21(4,5)20-10-6-9-19-11-18-13-12(19)7-8-17-14(13)16/h7-8,11H,6,9-10H2,1-5H3,(H2,16,17) |
| InChIKey | JSDJFFSWTPRYSA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|