C17H28BiNOSi — CID 151937116
[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]indol-5-yl]bismuthane (PubChem CID 151937116) has the molecular formula C17H28BiNOSi and a molecular weight of 499.48 g/mol. Its IUPAC name is [1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]indol-5-yl]bismuthane.
| Compound Name | [1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]indol-5-yl]bismuthane |
|---|---|
| PubChem CID | 151937116 |
| Molecular Formula | C17H28BiNOSi |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]indol-5-yl]bismuthane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCn1ccc2cc([BiH2])ccc21 |
| InChI | InChI=1S/C17H26NOSi.Bi.2H/c1-17(2,3)20(4,5)19-14-8-12-18-13-11-15-9-6-7-10-16(15)18;;;/h7,9-11,13H,8,12,14H2,1-5H3;;; |
| InChIKey | TTWKKEUOSJFDDT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|