C17H25ClN2O2Si — CID 169206265
1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloropyrrolo[3,2-b]pyridine-7-carbaldehyde (PubChem CID 169206265) has the molecular formula C17H25ClN2O2Si and a molecular weight of 352.94 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloropyrrolo[3,2-b]pyridine-7-carbaldehyde.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloropyrrolo[3,2-b]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 169206265 |
| Molecular Formula | C17H25ClN2O2Si |
| Molecular Weight | 352.94 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-chloropyrrolo[3,2-b]pyridine-7-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCn1ccc2nc(Cl)cc(C=O)c21 |
| InChI | InChI=1S/C17H25ClN2O2Si/c1-17(2,3)23(4,5)22-10-6-8-20-9-7-14-16(20)13(12-21)11-15(18)19-14/h7,9,11-12H,6,8,10H2,1-5H3 |
| InChIKey | FSHPBRVTFOVBSX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|