C17H24ClNO2Si — CID 89421812
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-1-methylindole-5-carbaldehyde (PubChem CID 89421812) has the molecular formula C17H24ClNO2Si and a molecular weight of 337.92 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-1-methylindole-5-carbaldehyde.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-1-methylindole-5-carbaldehyde |
|---|---|
| PubChem CID | 89421812 |
| Molecular Formula | C17H24ClNO2Si |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-1-methylindole-5-carbaldehyde |
| SMILES | Cn1c(CO[Si](C)(C)C(C)(C)C)cc2cc(C=O)c(Cl)cc21 |
| InChI | InChI=1S/C17H24ClNO2Si/c1-17(2,3)22(5,6)21-11-14-8-12-7-13(10-20)15(18)9-16(12)19(14)4/h7-10H,11H2,1-6H3 |
| InChIKey | JWJWLKXLMKMTON-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|