C18H27NOSi — CID 141366438
tert-butyl-[(4-ethenyl-1-methylindol-2-yl)methoxy]-dimethylsilane (PubChem CID 141366438) has the molecular formula C18H27NOSi and a molecular weight of 301.51 g/mol. Its IUPAC name is tert-butyl-[(4-ethenyl-1-methylindol-2-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4-ethenyl-1-methylindol-2-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 141366438 |
| Molecular Formula | C18H27NOSi |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | tert-butyl-[(4-ethenyl-1-methylindol-2-yl)methoxy]-dimethylsilane |
| SMILES | C=Cc1cccc2c1cc(CO[Si](C)(C)C(C)(C)C)n2C |
| InChI | InChI=1S/C18H27NOSi/c1-8-14-10-9-11-17-16(14)12-15(19(17)5)13-20-21(6,7)18(2,3)4/h8-12H,1,13H2,2-7H3 |
| InChIKey | XLKBUEJGGGXPEG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|