C19H27NO2Si — CID 89423009
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-1-methylindole-5-carbaldehyde (PubChem CID 89423009) has the molecular formula C19H27NO2Si and a molecular weight of 329.52 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-1-methylindole-5-carbaldehyde.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-1-methylindole-5-carbaldehyde |
|---|---|
| PubChem CID | 89423009 |
| Molecular Formula | C19H27NO2Si |
| Molecular Weight | 329.52 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethenyl-1-methylindole-5-carbaldehyde |
| SMILES | C=Cc1cc2c(cc1C=O)cc(CO[Si](C)(C)C(C)(C)C)n2C |
| InChI | InChI=1S/C19H27NO2Si/c1-8-14-11-18-15(9-16(14)12-21)10-17(20(18)5)13-22-23(6,7)19(2,3)4/h8-12H,1,13H2,2-7H3 |
| InChIKey | KZCDAQHKDMFVPX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|