C22H26O2Si — CID 11100219
2-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]benzaldehyde (PubChem CID 11100219) has the molecular formula C22H26O2Si and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]benzaldehyde.
| Compound Name | 2-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]benzaldehyde |
|---|---|
| PubChem CID | 11100219 |
| Molecular Formula | C22H26O2Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethynyl]benzaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccccc1C#Cc1ccccc1C=O |
| InChI | InChI=1S/C22H26O2Si/c1-22(2,3)25(4,5)24-17-21-13-9-7-11-19(21)15-14-18-10-6-8-12-20(18)16-23/h6-13,16H,17H2,1-5H3 |
| InChIKey | IMJLKZDRUCJCSN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|