C18H33NOSi2 — CID 14687071
(E)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-N-(trimethylsilylmethyl)methanimine (PubChem CID 14687071) has the molecular formula C18H33NOSi2 and a molecular weight of 335.64 g/mol. Its IUPAC name is (E)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-N-(trimethylsilylmethyl)methanimine.
| Compound Name | (E)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-N-(trimethylsilylmethyl)methanimine |
|---|---|
| PubChem CID | 14687071 |
| Molecular Formula | C18H33NOSi2 |
| Molecular Weight | 335.64 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (E)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-N-(trimethylsilylmethyl)methanimine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccccc1/C=N/C[Si](C)(C)C |
| InChI | InChI=1S/C18H33NOSi2/c1-18(2,3)22(7,8)20-14-17-12-10-9-11-16(17)13-19-15-21(4,5)6/h9-13H,14-15H2,1-8H3/b19-13+ |
| InChIKey | JVOQKAGSIDRESD-CPNJWEJPSA-N |
| XLogP | 5.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.64 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|