C23H28OSi — CID 11110861
tert-butyl-[[2-[(Z)-2-(2-ethynylphenyl)ethenyl]phenyl]methoxy]-dimethylsilane (PubChem CID 11110861) has the molecular formula C23H28OSi and a molecular weight of 348.56 g/mol. Its IUPAC name is tert-butyl-[[2-[(Z)-2-(2-ethynylphenyl)ethenyl]phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-[(Z)-2-(2-ethynylphenyl)ethenyl]phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11110861 |
| Molecular Formula | C23H28OSi |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | tert-butyl-[[2-[(Z)-2-(2-ethynylphenyl)ethenyl]phenyl]methoxy]-dimethylsilane |
| SMILES | C#Cc1ccccc1/C=C\c1ccccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H28OSi/c1-7-19-12-8-9-13-20(19)16-17-21-14-10-11-15-22(21)18-24-25(5,6)23(2,3)4/h1,8-17H,18H2,2-6H3/b17-16- |
| InChIKey | FHRAGVYMIPOHKG-MSUUIHNZSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|