C22H41O5PSi — CID 168825886
ditert-butyl [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl phosphate (PubChem CID 168825886) has the molecular formula C22H41O5PSi and a molecular weight of 444.63 g/mol. Its IUPAC name is ditert-butyl [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl phosphate.
| Compound Name | ditert-butyl [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl phosphate |
|---|---|
| PubChem CID | 168825886 |
| Molecular Formula | C22H41O5PSi |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ditert-butyl [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCc1ccccc1CO[Si](C)(C)C(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C22H41O5PSi/c1-20(2,3)26-28(23,27-21(4,5)6)24-16-18-14-12-13-15-19(18)17-25-29(10,11)22(7,8)9/h12-15H,16-17H2,1-11H3 |
| InChIKey | HUXNTPCGXYHYBH-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|