C27H52NO6PSi — CID 59283202
ditert-butyl [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] phosphate (PubChem CID 59283202) has the molecular formula C27H52NO6PSi and a molecular weight of 545.77 g/mol. Its IUPAC name is ditert-butyl [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] phosphate.
| Compound Name | ditert-butyl [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] phosphate |
|---|---|
| PubChem CID | 59283202 |
| Molecular Formula | C27H52NO6PSi |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | ditert-butyl [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] phosphate |
| SMILES | CC(C)(C)NCC(O)c1ccc(OP(=O)(OC(C)(C)C)OC(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C27H52NO6PSi/c1-24(2,3)28-18-22(29)20-15-16-23(21(17-20)19-31-36(13,14)27(10,11)12)32-35(30,33-25(4,5)6)34-26(7,8)9/h15-17,22,28-29H,18-19H2,1-14H3 |
| InChIKey | CZCUAGVLLOFAQU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|