C23H37NO5 — CID 13080840
[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylbutanoyloxy)phenyl]methyl 3-methylbutanoate (PubChem CID 13080840) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylbutanoyloxy)phenyl]methyl 3-methylbutanoate.
| Compound Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylbutanoyloxy)phenyl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 13080840 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylbutanoyloxy)phenyl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCc1cc(C(O)CNC(C)(C)C)ccc1OC(=O)CC(C)C |
| InChI | InChI=1S/C23H37NO5/c1-15(2)10-21(26)28-14-18-12-17(19(25)13-24-23(5,6)7)8-9-20(18)29-22(27)11-16(3)4/h8-9,12,15-16,19,24-25H,10-11,13-14H2,1-7H3 |
| InChIKey | QPYGOLDTQIZJIS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|