C21H27NO5 — CID 54120830
[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methyl 2-phenoxyacetate (PubChem CID 54120830) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methyl 2-phenoxyacetate.
| Compound Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 54120830 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methyl 2-phenoxyacetate |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(COC(=O)COc2ccccc2)c1 |
| InChI | InChI=1S/C21H27NO5/c1-21(2,3)22-12-19(24)15-9-10-18(23)16(11-15)13-27-20(25)14-26-17-7-5-4-6-8-17/h4-11,19,22-24H,12-14H2,1-3H3 |
| InChIKey | NNONXKKKQMJCHJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |