C19H23NO5 — CID 88755908
[2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 2-phenoxyacetate (PubChem CID 88755908) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 2-phenoxyacetate.
| Compound Name | [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 88755908 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 2-phenoxyacetate |
| SMILES | CC(C)NCC(O)c1ccc(OC(=O)COc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C19H23NO5/c1-13(2)20-11-17(22)14-8-9-18(16(21)10-14)25-19(23)12-24-15-6-4-3-5-7-15/h3-10,13,17,20-22H,11-12H2,1-2H3 |
| InChIKey | AKOOESCUZOTSHP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|