C20H27ClN2O4 — CID 70552828
[2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 3-(dimethylamino)benzoate;hydrochloride (PubChem CID 70552828) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 3-(dimethylamino)benzoate;hydrochloride.
| Compound Name | [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 3-(dimethylamino)benzoate;hydrochloride |
|---|---|
| PubChem CID | 70552828 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2-hydroxy-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 3-(dimethylamino)benzoate;hydrochloride |
| SMILES | CC(C)NCC(O)c1ccc(OC(=O)c2cccc(N(C)C)c2)c(O)c1.Cl |
| InChI | InChI=1S/C20H26N2O4.ClH/c1-13(2)21-12-18(24)14-8-9-19(17(23)11-14)26-20(25)15-6-5-7-16(10-15)22(3)4;/h5-11,13,18,21,23-24H,12H2,1-4H3;1H |
| InChIKey | LOIZKNAEGKICTF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|