C21H27NO6S — CID 88796784
[4-[2-(tert-butylamino)-1-methylsulfonyloxyethyl]-2-hydroxyphenyl] 3-methylbenzoate (PubChem CID 88796784) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-methylsulfonyloxyethyl]-2-hydroxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[2-(tert-butylamino)-1-methylsulfonyloxyethyl]-2-hydroxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 88796784 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-methylsulfonyloxyethyl]-2-hydroxyphenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C(CNC(C)(C)C)OS(C)(=O)=O)cc2O)c1 |
| InChI | InChI=1S/C21H27NO6S/c1-14-7-6-8-16(11-14)20(24)27-18-10-9-15(12-17(18)23)19(28-29(5,25)26)13-22-21(2,3)4/h6-12,19,22-23H,13H2,1-5H3 |
| InChIKey | OAFIQBSCQXYLJB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|