C31H37NO9S — CID 88754227
[4-[1-acetyloxy-2-(tert-butylamino)ethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid (PubChem CID 88754227) has the molecular formula C31H37NO9S and a molecular weight of 599.70 g/mol. Its IUPAC name is [4-[1-acetyloxy-2-(tert-butylamino)ethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid.
| Compound Name | [4-[1-acetyloxy-2-(tert-butylamino)ethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid |
|---|---|
| PubChem CID | 88754227 |
| Molecular Formula | C31H37NO9S |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | [4-[1-acetyloxy-2-(tert-butylamino)ethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid |
| SMILES | CC(=O)OC(CNC(C)(C)C)c1ccc(OC(=O)c2ccc(C)cc2)c(OC(=O)c2ccc(C)cc2)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C30H33NO6.CH4O3S/c1-19-7-11-22(12-8-19)28(33)36-25-16-15-24(27(35-21(3)32)18-31-30(4,5)6)17-26(25)37-29(34)23-13-9-20(2)10-14-23;1-5(2,3)4/h7-17,27,31H,18H2,1-6H3;1H3,(H,2,3,4) |
| InChIKey | FLALYSZVGMVMRR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|