C24H39NO5 — CID 90679687
[4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate (PubChem CID 90679687) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90679687 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc([C@@H](O)CNC(C)(C)C)cc1OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H39NO5/c1-22(2,3)13-20(27)29-18-11-10-16(17(26)15-25-24(7,8)9)12-19(18)30-21(28)14-23(4,5)6/h10-12,17,25-26H,13-15H2,1-9H3/t17-/m0/s1 |
| InChIKey | FTUYWXJNEVZYFJ-KRWDZBQOSA-N |
| XLogP | 4.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|