C24H34ClNO5 — CID 70554536
[2-acetyloxy-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] acetate;ethylbenzene;hydrochloride (PubChem CID 70554536) has the molecular formula C24H34ClNO5 and a molecular weight of 451.99 g/mol. Its IUPAC name is [2-acetyloxy-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] acetate;ethylbenzene;hydrochloride.
| Compound Name | [2-acetyloxy-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] acetate;ethylbenzene;hydrochloride |
|---|---|
| PubChem CID | 70554536 |
| Molecular Formula | C24H34ClNO5 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | [2-acetyloxy-4-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] acetate;ethylbenzene;hydrochloride |
| SMILES | CC(=O)Oc1ccc(C(O)CNC(C)(C)C)cc1OC(C)=O.CCc1ccccc1.Cl |
| InChI | InChI=1S/C16H23NO5.C8H10.ClH/c1-10(18)21-14-7-6-12(8-15(14)22-11(2)19)13(20)9-17-16(3,4)5;1-2-8-6-4-3-5-7-8;/h6-8,13,17,20H,9H2,1-5H3;3-7H,2H2,1H3;1H |
| InChIKey | IINMVYQQJWULEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|