C24H35NO5 — CID 54083988
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate (PubChem CID 54083988) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 54083988 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(cyclopentanecarbonyloxy)phenyl] cyclopentanecarboxylate |
| SMILES | CC(C)(C)NCC(O)c1ccc(OC(=O)C2CCCC2)c(OC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C24H35NO5/c1-24(2,3)25-15-19(26)18-12-13-20(29-22(27)16-8-4-5-9-16)21(14-18)30-23(28)17-10-6-7-11-17/h12-14,16-17,19,25-26H,4-11,15H2,1-3H3 |
| InChIKey | MPCLMQOONVMRDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|