C25H37NO4 — CID 19794520
[2-(cyclohexanecarbonyloxy)-4-[2-(propan-2-ylamino)ethyl]phenyl] cyclohexanecarboxylate (PubChem CID 19794520) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [2-(cyclohexanecarbonyloxy)-4-[2-(propan-2-ylamino)ethyl]phenyl] cyclohexanecarboxylate.
| Compound Name | [2-(cyclohexanecarbonyloxy)-4-[2-(propan-2-ylamino)ethyl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 19794520 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [2-(cyclohexanecarbonyloxy)-4-[2-(propan-2-ylamino)ethyl]phenyl] cyclohexanecarboxylate |
| SMILES | CC(C)NCCc1ccc(OC(=O)C2CCCCC2)c(OC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H37NO4/c1-18(2)26-16-15-19-13-14-22(29-24(27)20-9-5-3-6-10-20)23(17-19)30-25(28)21-11-7-4-8-12-21/h13-14,17-18,20-21,26H,3-12,15-16H2,1-2H3 |
| InChIKey | GUBVULDKSMYSPQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|