C21H28ClNO4 — CID 70554127
[3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride (PubChem CID 70554127) has the molecular formula C21H28ClNO4 and a molecular weight of 393.91 g/mol. Its IUPAC name is [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride.
| Compound Name | [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride |
|---|---|
| PubChem CID | 70554127 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1cc2ccc(CCNC(C)C)cc2cc1OC(=O)CC.Cl |
| InChI | InChI=1S/C21H27NO4.ClH/c1-5-20(23)25-18-12-16-8-7-15(9-10-22-14(3)4)11-17(16)13-19(18)26-21(24)6-2;/h7-8,11-14,22H,5-6,9-10H2,1-4H3;1H |
| InChIKey | KYXUPWDEHHFRJE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|