About [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride
[3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride (PubChem CID 70554127) has the molecular formula C21H28ClNO4
and a molecular weight of 393.91 g/mol. Its IUPAC name is [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride.
Molecular Properties
| Compound Name | [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride |
| PubChem CID | 70554127 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1cc2ccc(CCNC(C)C)cc2cc1OC(=O)CC.Cl |
| InChI | InChI=1S/C21H27NO4.ClH/c1-5-20(23)25-18-12-16-8-7-15(9-10-22-14(3)4)11-17(16)13-19(18)26-21(24)6-2;/h7-8,11-14,22H,5-6,9-10H2,1-4H3;1H |
| InChIKey | KYXUPWDEHHFRJE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride?
The IUPAC name of [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride (CID 70554127) is [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride.
What is the SMILES notation for [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride?
The canonical SMILES for [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride is CCC(=O)Oc1cc2ccc(CCNC(C)C)cc2cc1OC(=O)CC.Cl.
What is the InChIKey of [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride?
The InChIKey is KYXUPWDEHHFRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4.ClH/c1-5-20(23)25-18-12-16-8-7-15(9-10-22-14(3)4)11-17(16)13-19(18)26-21(24)6-2;/h7-8,11-14,22H,5-6,9-10H2,1-4H3;1H.
What are the key properties of [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride?
[3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride has a molecular weight of 393.91 g/mol, XLogP of 4.43, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-propanoyloxy-6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] propanoate;hydrochloride is sourced from PubChem (CID 70554127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).