C24H32ClNO4 — CID 70551238
[6-[2-(2-methylpiperidin-1-yl)ethyl]-3-propanoyloxynaphthalen-2-yl] propanoate;hydrochloride (PubChem CID 70551238) has the molecular formula C24H32ClNO4 and a molecular weight of 433.98 g/mol. Its IUPAC name is [6-[2-(2-methylpiperidin-1-yl)ethyl]-3-propanoyloxynaphthalen-2-yl] propanoate;hydrochloride.
| Compound Name | [6-[2-(2-methylpiperidin-1-yl)ethyl]-3-propanoyloxynaphthalen-2-yl] propanoate;hydrochloride |
|---|---|
| PubChem CID | 70551238 |
| Molecular Formula | C24H32ClNO4 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [6-[2-(2-methylpiperidin-1-yl)ethyl]-3-propanoyloxynaphthalen-2-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1cc2ccc(CCN3CCCCC3C)cc2cc1OC(=O)CC.Cl |
| InChI | InChI=1S/C24H31NO4.ClH/c1-4-23(26)28-21-15-19-10-9-18(11-13-25-12-7-6-8-17(25)3)14-20(19)16-22(21)29-24(27)5-2;/h9-10,14-17H,4-8,11-13H2,1-3H3;1H |
| InChIKey | HFXTZXFVVSDEMW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|