C25H38ClNO6 — CID 20541860
6-[(2-methylpiperidin-1-yl)methyl]naphthalene-2,3-diol;bis(2-methylpropanoic acid);hydrochloride (PubChem CID 20541860) has the molecular formula C25H38ClNO6 and a molecular weight of 484.03 g/mol. Its IUPAC name is 6-[(2-methylpiperidin-1-yl)methyl]naphthalene-2,3-diol;bis(2-methylpropanoic acid);hydrochloride.
| Compound Name | 6-[(2-methylpiperidin-1-yl)methyl]naphthalene-2,3-diol;bis(2-methylpropanoic acid);hydrochloride |
|---|---|
| PubChem CID | 20541860 |
| Molecular Formula | C25H38ClNO6 |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 6-[(2-methylpiperidin-1-yl)methyl]naphthalene-2,3-diol;bis(2-methylpropanoic acid);hydrochloride |
| SMILES | CC(C)C(=O)O.CC(C)C(=O)O.CC1CCCCN1Cc1ccc2cc(O)c(O)cc2c1.Cl |
| InChI | InChI=1S/C17H21NO2.2C4H8O2.ClH/c1-12-4-2-3-7-18(12)11-13-5-6-14-9-16(19)17(20)10-15(14)8-13;2*1-3(2)4(5)6;/h5-6,8-10,12,19-20H,2-4,7,11H2,1H3;2*3H,1-2H3,(H,5,6);1H |
| InChIKey | JBZVRQFGHRRIEI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|