C11H12Br2O2 — CID 134898063
[2,5-bis(bromomethyl)phenyl] propanoate (PubChem CID 134898063) has the molecular formula C11H12Br2O2 and a molecular weight of 336.02 g/mol. Its IUPAC name is [2,5-bis(bromomethyl)phenyl] propanoate.
| Compound Name | [2,5-bis(bromomethyl)phenyl] propanoate |
|---|---|
| PubChem CID | 134898063 |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | [2,5-bis(bromomethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(CBr)ccc1CBr |
| InChI | InChI=1S/C11H12Br2O2/c1-2-11(14)15-10-5-8(6-12)3-4-9(10)7-13/h3-5H,2,6-7H2,1H3 |
| InChIKey | PERVHZMRPGGGFT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|