About [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide
[6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide (PubChem CID 70553384) has the molecular formula C22H24BrNO2
and a molecular weight of 414.34 g/mol. Its IUPAC name is [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide.
Molecular Properties
| Compound Name | [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide |
| PubChem CID | 70553384 |
| Molecular Formula | C22H24BrNO2 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide |
| SMILES | Br.CC(C)NCCc1ccc2cc(OC(=O)c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C22H23NO2.BrH/c1-16(2)23-13-12-17-8-9-20-15-21(11-10-19(20)14-17)25-22(24)18-6-4-3-5-7-18;/h3-11,14-16,23H,12-13H2,1-2H3;1H |
| InChIKey | XHPNNMZMVNIHTE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide?
The IUPAC name of [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide (CID 70553384) is [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide.
What is the SMILES notation for [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide?
The canonical SMILES for [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide is Br.CC(C)NCCc1ccc2cc(OC(=O)c3ccccc3)ccc2c1.
What is the InChIKey of [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide?
The InChIKey is XHPNNMZMVNIHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2.BrH/c1-16(2)23-13-12-17-8-9-20-15-21(11-10-19(20)14-17)25-22(24)18-6-4-3-5-7-18;/h3-11,14-16,23H,12-13H2,1-2H3;1H.
What are the key properties of [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide?
[6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide has a molecular weight of 414.34 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(propan-2-ylamino)ethyl]naphthalen-2-yl] benzoate;hydrobromide is sourced from PubChem (CID 70553384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).