C27H21NO5 — CID 141449215
2-benzamido-3-(6-benzoyloxynaphthalen-2-yl)propanoic acid (PubChem CID 141449215) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-benzamido-3-(6-benzoyloxynaphthalen-2-yl)propanoic acid.
| Compound Name | 2-benzamido-3-(6-benzoyloxynaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 141449215 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-benzamido-3-(6-benzoyloxynaphthalen-2-yl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc2cc(OC(=O)c3ccccc3)ccc2c1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H21NO5/c29-25(19-7-3-1-4-8-19)28-24(26(30)31)16-18-11-12-22-17-23(14-13-21(22)15-18)33-27(32)20-9-5-2-6-10-20/h1-15,17,24H,16H2,(H,28,29)(H,30,31) |
| InChIKey | YWGRWBOLGNOALP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|