About [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide
[6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide (PubChem CID 70551589) has the molecular formula C21H22BrNO2
and a molecular weight of 400.32 g/mol. Its IUPAC name is [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide.
Molecular Properties
| Compound Name | [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide |
| PubChem CID | 70551589 |
| Molecular Formula | C21H22BrNO2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide |
| SMILES | Br.CC(=O)Oc1ccc2cc(CCNCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C21H21NO2.BrH/c1-16(23)24-21-10-9-19-13-17(7-8-20(19)14-21)11-12-22-15-18-5-3-2-4-6-18;/h2-10,13-14,22H,11-12,15H2,1H3;1H |
| InChIKey | UVGSRFNWEUAWSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide?
The IUPAC name of [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide (CID 70551589) is [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide.
What is the SMILES notation for [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide?
The canonical SMILES for [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide is Br.CC(=O)Oc1ccc2cc(CCNCc3ccccc3)ccc2c1.
What is the InChIKey of [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide?
The InChIKey is UVGSRFNWEUAWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2.BrH/c1-16(23)24-21-10-9-19-13-17(7-8-20(19)14-21)11-12-22-15-18-5-3-2-4-6-18;/h2-10,13-14,22H,11-12,15H2,1H3;1H.
What are the key properties of [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide?
[6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide has a molecular weight of 400.32 g/mol, XLogP of 4.68, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2-(benzylamino)ethyl]naphthalen-2-yl] acetate;hydrobromide is sourced from PubChem (CID 70551589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).