C24H40ClNO5 — CID 70553089
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate;hydrochloride (PubChem CID 70553089) has the molecular formula C24H40ClNO5 and a molecular weight of 458.04 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate;hydrochloride.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 70553089 |
| Molecular Formula | C24H40ClNO5 |
| Molecular Weight | 458.04 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate;hydrochloride |
| SMILES | CCC(C)CC(=O)Oc1ccc(C(O)CNC(C)(C)C)cc1OC(=O)CC(C)CC.Cl |
| InChI | InChI=1S/C24H39NO5.ClH/c1-8-16(3)12-22(27)29-20-11-10-18(19(26)15-25-24(5,6)7)14-21(20)30-23(28)13-17(4)9-2;/h10-11,14,16-17,19,25-26H,8-9,12-13,15H2,1-7H3;1H |
| InChIKey | ZNKFVVRZHOSPRC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.04 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|