C23H38ClNO5 — CID 70552688
[4-[2-(tert-butylamino)-1-hydroxypropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate;hydrochloride (PubChem CID 70552688) has the molecular formula C23H38ClNO5 and a molecular weight of 444.01 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxypropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate;hydrochloride.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxypropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 70552688 |
| Molecular Formula | C23H38ClNO5 |
| Molecular Weight | 444.01 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxypropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate;hydrochloride |
| SMILES | CC(C)CC(=O)Oc1ccc(C(O)C(C)NC(C)(C)C)cc1OC(=O)CC(C)C.Cl |
| InChI | InChI=1S/C23H37NO5.ClH/c1-14(2)11-20(25)28-18-10-9-17(22(27)16(5)24-23(6,7)8)13-19(18)29-21(26)12-15(3)4;/h9-10,13-16,22,24,27H,11-12H2,1-8H3;1H |
| InChIKey | XVVSJNZJWQSQDW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.01 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|