C22H35NO5 — CID 70463268
[2-(3,3-dimethylbutanoyloxy)-4-[1-hydroxy-2-(methylamino)propyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 70463268) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is [2-(3,3-dimethylbutanoyloxy)-4-[1-hydroxy-2-(methylamino)propyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [2-(3,3-dimethylbutanoyloxy)-4-[1-hydroxy-2-(methylamino)propyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 70463268 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [2-(3,3-dimethylbutanoyloxy)-4-[1-hydroxy-2-(methylamino)propyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | CNC(C)C(O)c1ccc(OC(=O)CC(C)(C)C)c(OC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C22H35NO5/c1-14(23-8)20(26)15-9-10-16(27-18(24)12-21(2,3)4)17(11-15)28-19(25)13-22(5,6)7/h9-11,14,20,23,26H,12-13H2,1-8H3 |
| InChIKey | GWFVHUGXKVNLSK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|