C21H30N2O5 — CID 163437891
[4-[(Z)-2,3-diamino-3-oxoprop-1-enyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate (PubChem CID 163437891) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is [4-[(Z)-2,3-diamino-3-oxoprop-1-enyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[(Z)-2,3-diamino-3-oxoprop-1-enyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 163437891 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [4-[(Z)-2,3-diamino-3-oxoprop-1-enyl]-2-(3,3-dimethylbutanoyloxy)phenyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc(/C=C(\N)C(N)=O)cc1OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C21H30N2O5/c1-20(2,3)11-17(24)27-15-8-7-13(9-14(22)19(23)26)10-16(15)28-18(25)12-21(4,5)6/h7-10H,11-12,22H2,1-6H3,(H2,23,26)/b14-9- |
| InChIKey | AWBDJTQFGYNADA-ZROIWOOFSA-N |
| XLogP | 3.15 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|