C13H14ClF3O2 — CID 90868666
[2-chloro-4-(trifluoromethyl)phenyl] 3,3-dimethylbutanoate (PubChem CID 90868666) has the molecular formula C13H14ClF3O2 and a molecular weight of 294.70 g/mol. Its IUPAC name is [2-chloro-4-(trifluoromethyl)phenyl] 3,3-dimethylbutanoate.
| Compound Name | [2-chloro-4-(trifluoromethyl)phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90868666 |
| Molecular Formula | C13H14ClF3O2 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [2-chloro-4-(trifluoromethyl)phenyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H14ClF3O2/c1-12(2,3)7-11(18)19-10-5-4-8(6-9(10)14)13(15,16)17/h4-6H,7H2,1-3H3 |
| InChIKey | JBNUGMRBVYHDFS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|