C36H34Cl2F6O9P+ — CID 88670990
bis[3-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-hydroxy-3-methylbutoxy]-oxophosphanium (PubChem CID 88670990) has the molecular formula C36H34Cl2F6O9P+ and a molecular weight of 826.53 g/mol. Its IUPAC name is bis[3-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-hydroxy-3-methylbutoxy]-oxophosphanium.
| Compound Name | bis[3-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-hydroxy-3-methylbutoxy]-oxophosphanium |
|---|---|
| PubChem CID | 88670990 |
| Molecular Formula | C36H34Cl2F6O9P+ |
| Molecular Weight | 826.53 g/mol |
| Exact Mass | 825.12 |
| IUPAC Name | bis[3-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-2-hydroxy-3-methylbutoxy]-oxophosphanium |
| SMILES | CC(C)(Oc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1)C(O)CO[P+](=O)OCC(O)C(C)(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C36H34Cl2F6O9P/c1-33(2,52-25-11-7-23(8-12-25)50-29-15-5-21(17-27(29)37)35(39,40)41)31(45)19-48-54(47)49-20-32(46)34(3,4)53-26-13-9-24(10-14-26)51-30-16-6-22(18-28(30)38)36(42,43)44/h5-18,31-32,45-46H,19-20H2,1-4H3/q+1 |
| InChIKey | IYDGZYXYHBRTAJ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.53 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|