C13H14BrNO2 — CID 90986250
(4-bromo-2-cyanophenyl) 3,3-dimethylbutanoate (PubChem CID 90986250) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is (4-bromo-2-cyanophenyl) 3,3-dimethylbutanoate.
| Compound Name | (4-bromo-2-cyanophenyl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90986250 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (4-bromo-2-cyanophenyl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc(Br)cc1C#N |
| InChI | InChI=1S/C13H14BrNO2/c1-13(2,3)7-12(16)17-11-5-4-10(14)6-9(11)8-15/h4-6H,7H2,1-3H3 |
| InChIKey | VQXAAFDLUZWHPG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|