C12H14BrN3O2 — CID 83145468
2-(4-bromo-2-cyanophenoxy)-3-methylbutanehydrazide (PubChem CID 83145468) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-(4-bromo-2-cyanophenoxy)-3-methylbutanehydrazide.
| Compound Name | 2-(4-bromo-2-cyanophenoxy)-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 83145468 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-(4-bromo-2-cyanophenoxy)-3-methylbutanehydrazide |
| SMILES | CC(C)C(Oc1ccc(Br)cc1C#N)C(=O)NN |
| InChI | InChI=1S/C12H14BrN3O2/c1-7(2)11(12(17)16-15)18-10-4-3-9(13)5-8(10)6-14/h3-5,7,11H,15H2,1-2H3,(H,16,17) |
| InChIKey | JQAZAERNTQZQDY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|