C22H34ClNO8 — CID 154477580
[2-(3,3-dimethylbutanoyloxy)-4-[3-(methylamino)-1-perchloryloxypropyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 154477580) has the molecular formula C22H34ClNO8 and a molecular weight of 475.97 g/mol. Its IUPAC name is [2-(3,3-dimethylbutanoyloxy)-4-[3-(methylamino)-1-perchloryloxypropyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [2-(3,3-dimethylbutanoyloxy)-4-[3-(methylamino)-1-perchloryloxypropyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 154477580 |
| Molecular Formula | C22H34ClNO8 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [2-(3,3-dimethylbutanoyloxy)-4-[3-(methylamino)-1-perchloryloxypropyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | CNCCC(O[Cl+3]([O-])([O-])[O-])c1ccc(OC(=O)CC(C)(C)C)c(OC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C22H34ClNO8/c1-21(2,3)13-19(25)30-17-9-8-15(16(10-11-24-7)32-23(27,28)29)12-18(17)31-20(26)14-22(4,5)6/h8-9,12,16,24H,10-11,13-14H2,1-7H3 |
| InChIKey | KBDIXIXEXFVWED-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 143.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|