C16H19NO7 — CID 539820
[4-(2-acetamido-1-acetyloxyethyl)-2-acetyloxyphenyl] acetate (PubChem CID 539820) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is [4-(2-acetamido-1-acetyloxyethyl)-2-acetyloxyphenyl] acetate.
| Compound Name | [4-(2-acetamido-1-acetyloxyethyl)-2-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 539820 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [4-(2-acetamido-1-acetyloxyethyl)-2-acetyloxyphenyl] acetate |
| SMILES | CC(=O)NCC(OC(C)=O)c1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C16H19NO7/c1-9(18)17-8-16(24-12(4)21)13-5-6-14(22-10(2)19)15(7-13)23-11(3)20/h5-7,16H,8H2,1-4H3,(H,17,18) |
| InChIKey | KWZHCLSAXAIWJN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|