C21H31NO5 — CID 139641581
[2-acetyloxy-4-[1-(octylamino)-1-oxopropan-2-yl]phenyl] acetate (PubChem CID 139641581) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-acetyloxy-4-[1-(octylamino)-1-oxopropan-2-yl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[1-(octylamino)-1-oxopropan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 139641581 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [2-acetyloxy-4-[1-(octylamino)-1-oxopropan-2-yl]phenyl] acetate |
| SMILES | CCCCCCCCNC(=O)C(C)c1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C21H31NO5/c1-5-6-7-8-9-10-13-22-21(25)15(2)18-11-12-19(26-16(3)23)20(14-18)27-17(4)24/h11-12,14-15H,5-10,13H2,1-4H3,(H,22,25) |
| InChIKey | JNVSPAHEDOXYBS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|