C23H35NO5 — CID 139641573
[2-acetyloxy-4-[1-(decylamino)-1-oxopropan-2-yl]phenyl] acetate (PubChem CID 139641573) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is [2-acetyloxy-4-[1-(decylamino)-1-oxopropan-2-yl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[1-(decylamino)-1-oxopropan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 139641573 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [2-acetyloxy-4-[1-(decylamino)-1-oxopropan-2-yl]phenyl] acetate |
| SMILES | CCCCCCCCCCNC(=O)C(C)c1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C23H35NO5/c1-5-6-7-8-9-10-11-12-15-24-23(27)17(2)20-13-14-21(28-18(3)25)22(16-20)29-19(4)26/h13-14,16-17H,5-12,15H2,1-4H3,(H,24,27) |
| InChIKey | LAWFPVWBHHSODQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|