C12H11BrO6 — CID 14050771
2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid (PubChem CID 14050771) has the molecular formula C12H11BrO6 and a molecular weight of 331.12 g/mol. Its IUPAC name is 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid.
| Compound Name | 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 14050771 |
| Molecular Formula | C12H11BrO6 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid |
| SMILES | CC(=O)Oc1ccc(C(Br)C(=O)O)cc1OC(C)=O |
| InChI | InChI=1S/C12H11BrO6/c1-6(14)18-9-4-3-8(11(13)12(16)17)5-10(9)19-7(2)15/h3-5,11H,1-2H3,(H,16,17) |
| InChIKey | ORSONBIIQJAGTR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|