2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid

C12H11BrO6 — CID 14050771

IUPAC2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid
SMILESCC(=O)Oc1ccc(C(Br)C(=O)O)cc1OC(C)=O
InChIInChI=1S/C12H11BrO6/c1-6(14)18-9-4-3-8(11(13)12(16)17)5-10(9)19-7(2)15/h3-5,11H,1-2H3,(H,16,17)
InChIKeyORSONBIIQJAGTR-UHFFFAOYSA-N
MW331.12 g/mol
LogP2.06
Rot. Bonds4

About 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid

2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid (PubChem CID 14050771) has the molecular formula C12H11BrO6 and a molecular weight of 331.12 g/mol. Its IUPAC name is 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid.

Molecular Properties

Compound Name2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid
PubChem CID14050771
Molecular FormulaC12H11BrO6
Molecular Weight331.12 g/mol
Exact Mass329.97
IUPAC Name2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid
SMILESCC(=O)Oc1ccc(C(Br)C(=O)O)cc1OC(C)=O
InChIInChI=1S/C12H11BrO6/c1-6(14)18-9-4-3-8(11(13)12(16)17)5-10(9)19-7(2)15/h3-5,11H,1-2H3,(H,16,17)
InChIKeyORSONBIIQJAGTR-UHFFFAOYSA-N
XLogP2.06
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.12
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid?
The IUPAC name of 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid (CID 14050771) is 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid.
What is the SMILES notation for 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid?
The canonical SMILES for 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid is CC(=O)Oc1ccc(C(Br)C(=O)O)cc1OC(C)=O.
What is the InChIKey of 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid?
The InChIKey is ORSONBIIQJAGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO6/c1-6(14)18-9-4-3-8(11(13)12(16)17)5-10(9)19-7(2)15/h3-5,11H,1-2H3,(H,16,17).
What are the key properties of 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid?
2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid has a molecular weight of 331.12 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-(3,4-diacetyloxyphenyl)acetic acid is sourced from PubChem (CID 14050771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).