C22H31NO8 — CID 66947365
(2S)-2-amino-3-(3,4-diacetyloxyphenyl)-5-(2,3-dimethylbutanoyloxy)hexanoic acid (PubChem CID 66947365) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-diacetyloxyphenyl)-5-(2,3-dimethylbutanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-(3,4-diacetyloxyphenyl)-5-(2,3-dimethylbutanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66947365 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (2S)-2-amino-3-(3,4-diacetyloxyphenyl)-5-(2,3-dimethylbutanoyloxy)hexanoic acid |
| SMILES | CC(=O)Oc1ccc(C(CC(C)OC(=O)C(C)C(C)C)[C@H](N)C(=O)O)cc1OC(C)=O |
| InChI | InChI=1S/C22H31NO8/c1-11(2)13(4)22(28)29-12(3)9-17(20(23)21(26)27)16-7-8-18(30-14(5)24)19(10-16)31-15(6)25/h7-8,10-13,17,20H,9,23H2,1-6H3,(H,26,27)/t12?,13?,17?,20-/m0/s1 |
| InChIKey | QEVYHOZPUPQEPQ-SJIQTRCJSA-N |
| XLogP | 2.65 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|