C23H33NO8 — CID 66945883
(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-propanoyloxyhexanoic acid (PubChem CID 66945883) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-propanoyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-propanoyloxyhexanoic acid |
|---|---|
| PubChem CID | 66945883 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]-5-propanoyloxyhexanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C(CC(C)OC(=O)CC)[C@H](N)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C23H33NO8/c1-5-8-20(26)31-17-11-10-15(13-18(17)32-21(27)9-6-2)16(22(24)23(28)29)12-14(4)30-19(25)7-3/h10-11,13-14,16,22H,5-9,12,24H2,1-4H3,(H,28,29)/t14?,16?,22-/m0/s1 |
| InChIKey | JUQUFBASFGJRKJ-AWBPIWROSA-N |
| XLogP | 3.32 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|