C28H43NO8 — CID 66944352
(2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]-5-hexanoyloxyhexanoic acid (PubChem CID 66944352) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]-5-hexanoyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]-5-hexanoyloxyhexanoic acid |
|---|---|
| PubChem CID | 66944352 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]-5-hexanoyloxyhexanoic acid |
| SMILES | CCCCCC(=O)OC(C)CC(c1ccc(OC(=O)CC(C)C)c(OC(=O)CC(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C28H43NO8/c1-7-8-9-10-24(30)35-19(6)15-21(27(29)28(33)34)20-11-12-22(36-25(31)13-17(2)3)23(16-20)37-26(32)14-18(4)5/h11-12,16-19,21,27H,7-10,13-15,29H2,1-6H3,(H,33,34)/t19?,21?,27-/m0/s1 |
| InChIKey | VFPZYEBNFYPXCK-GASOQUEOSA-N |
| XLogP | 4.99 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|