C30H47NO9 — CID 66947059
(2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-5-(3-methylbutoxycarbonyloxy)hexanoic acid (PubChem CID 66947059) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-5-(3-methylbutoxycarbonyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-5-(3-methylbutoxycarbonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66947059 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(hexanoyloxy)phenyl]-5-(3-methylbutoxycarbonyloxy)hexanoic acid |
| SMILES | CCCCCC(=O)Oc1ccc(C(CC(C)OC(=O)OCCC(C)C)[C@H](N)C(=O)O)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C30H47NO9/c1-6-8-10-12-26(32)39-24-15-14-22(19-25(24)40-27(33)13-11-9-7-2)23(28(31)29(34)35)18-21(5)38-30(36)37-17-16-20(3)4/h14-15,19-21,23,28H,6-13,16-18,31H2,1-5H3,(H,34,35)/t21?,23?,28-/m0/s1 |
| InChIKey | WDBKPENCEUNHJC-QZDZRYIRSA-N |
| XLogP | 6.13 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|