C29H45NO10 — CID 66945362
(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-5-(3-methylbutanoyloxy)hexanoic acid (PubChem CID 66945362) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-5-(3-methylbutanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-5-(3-methylbutanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66945362 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-5-(3-methylbutanoyloxy)hexanoic acid |
| SMILES | CC(C)CCOC(=O)Oc1ccc(C(CC(C)OC(=O)CC(C)C)[C@H](N)C(=O)O)cc1OC(=O)OCCC(C)C |
| InChI | InChI=1S/C29H45NO10/c1-17(2)10-12-36-28(34)39-23-9-8-21(16-24(23)40-29(35)37-13-11-18(3)4)22(26(30)27(32)33)15-20(7)38-25(31)14-19(5)6/h8-9,16-20,22,26H,10-15,30H2,1-7H3,(H,32,33)/t20?,22?,26-/m0/s1 |
| InChIKey | CRSDJWNDGBPQTM-UXNJHFGPSA-N |
| XLogP | 5.67 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|