C25H37NO10 — CID 66944351
(2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-(2-methylbutanoyloxy)hexanoic acid (PubChem CID 66944351) has the molecular formula C25H37NO10 and a molecular weight of 511.57 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-(2-methylbutanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-(2-methylbutanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66944351 |
| Molecular Formula | C25H37NO10 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(propoxycarbonyloxy)phenyl]-5-(2-methylbutanoyloxy)hexanoic acid |
| SMILES | CCCOC(=O)Oc1ccc(C(CC(C)OC(=O)C(C)CC)[C@H](N)C(=O)O)cc1OC(=O)OCCC |
| InChI | InChI=1S/C25H37NO10/c1-6-11-32-24(30)35-19-10-9-17(14-20(19)36-25(31)33-12-7-2)18(21(26)22(27)28)13-16(5)34-23(29)15(4)8-3/h9-10,14-16,18,21H,6-8,11-13,26H2,1-5H3,(H,27,28)/t15?,16?,18?,21-/m0/s1 |
| InChIKey | QPHOFSPGSABMIS-MGGPMZQCSA-N |
| XLogP | 4.40 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|